C16H24BrN3O4 — CID 165430538
tert-butyl N-[2-[2-[(4-bromophenyl)carbamoylamino]ethoxy]ethyl]carbamate (PubChem CID 165430538) has the molecular formula C16H24BrN3O4 and a molecular weight of 402.29 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[(4-bromophenyl)carbamoylamino]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[(4-bromophenyl)carbamoylamino]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 165430538 |
| Molecular Formula | C16H24BrN3O4 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | tert-butyl N-[2-[2-[(4-bromophenyl)carbamoylamino]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCNC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H24BrN3O4/c1-16(2,3)24-15(22)19-9-11-23-10-8-18-14(21)20-13-6-4-12(17)5-7-13/h4-7H,8-11H2,1-3H3,(H,19,22)(H2,18,20,21) |
| InChIKey | CGWXIJXGEXLMNY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|