C20H28N2O6 — CID 155475619
2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl (E)-3-(4-acetamidophenyl)prop-2-enoate (PubChem CID 155475619) has the molecular formula C20H28N2O6 and a molecular weight of 392.45 g/mol. Its IUPAC name is 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl (E)-3-(4-acetamidophenyl)prop-2-enoate.
| Compound Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl (E)-3-(4-acetamidophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 155475619 |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl (E)-3-(4-acetamidophenyl)prop-2-enoate |
| SMILES | CC(=O)Nc1ccc(/C=C/C(=O)OCCOCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H28N2O6/c1-15(23)22-17-8-5-16(6-9-17)7-10-18(24)27-14-13-26-12-11-21-19(25)28-20(2,3)4/h5-10H,11-14H2,1-4H3,(H,21,25)(H,22,23)/b10-7+ |
| InChIKey | OOZCOGFYHXIGBS-JXMROGBWSA-N |
| XLogP | 2.74 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|