C21H29NO6 — CID 155475796
2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl (2E,4E)-5-(4-methoxyphenyl)penta-2,4-dienoate (PubChem CID 155475796) has the molecular formula C21H29NO6 and a molecular weight of 391.46 g/mol. Its IUPAC name is 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl (2E,4E)-5-(4-methoxyphenyl)penta-2,4-dienoate.
| Compound Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl (2E,4E)-5-(4-methoxyphenyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 155475796 |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl (2E,4E)-5-(4-methoxyphenyl)penta-2,4-dienoate |
| SMILES | COc1ccc(/C=C/C=C/C(=O)OCCOCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H29NO6/c1-21(2,3)28-20(24)22-13-14-26-15-16-27-19(23)8-6-5-7-17-9-11-18(25-4)12-10-17/h5-12H,13-16H2,1-4H3,(H,22,24)/b7-5+,8-6+ |
| InChIKey | SURPCQGMPFKUAJ-KQQUZDAGSA-N |
| XLogP | 3.35 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|