C16H21NO3 — CID 155475595
3-(methylamino)propyl (2E,4E)-5-(4-methoxyphenyl)penta-2,4-dienoate (PubChem CID 155475595) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-(methylamino)propyl (2E,4E)-5-(4-methoxyphenyl)penta-2,4-dienoate.
| Compound Name | 3-(methylamino)propyl (2E,4E)-5-(4-methoxyphenyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 155475595 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 3-(methylamino)propyl (2E,4E)-5-(4-methoxyphenyl)penta-2,4-dienoate |
| SMILES | CNCCCOC(=O)/C=C/C=C/c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H21NO3/c1-17-12-5-13-20-16(18)7-4-3-6-14-8-10-15(19-2)11-9-14/h3-4,6-11,17H,5,12-13H2,1-2H3/b6-3+,7-4+ |
| InChIKey | XRSCVWSIRBIOJG-XOKGJFMYSA-N |
| XLogP | 2.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|