C34H44N2O8 — CID 158576466
2-(2,2-dimethylbutanoylamino)ethyl (E)-3-(4-methoxyphenyl)prop-2-enoate;2-(2-methylprop-2-enoylamino)ethyl (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 158576466) has the molecular formula C34H44N2O8 and a molecular weight of 608.73 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoylamino)ethyl (E)-3-(4-methoxyphenyl)prop-2-enoate;2-(2-methylprop-2-enoylamino)ethyl (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | 2-(2,2-dimethylbutanoylamino)ethyl (E)-3-(4-methoxyphenyl)prop-2-enoate;2-(2-methylprop-2-enoylamino)ethyl (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 158576466 |
| Molecular Formula | C34H44N2O8 |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.31 |
| IUPAC Name | 2-(2,2-dimethylbutanoylamino)ethyl (E)-3-(4-methoxyphenyl)prop-2-enoate;2-(2-methylprop-2-enoylamino)ethyl (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)NCCOC(=O)/C=C/c1ccc(OC)cc1.CCC(C)(C)C(=O)NCCOC(=O)/C=C/c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H25NO4.C16H19NO4/c1-5-18(2,3)17(21)19-12-13-23-16(20)11-8-14-6-9-15(22-4)10-7-14;1-12(2)16(19)17-10-11-21-15(18)9-6-13-4-7-14(20-3)8-5-13/h6-11H,5,12-13H2,1-4H3,(H,19,21);4-9H,1,10-11H2,2-3H3,(H,17,19)/b11-8+;9-6+ |
| InChIKey | HSSJHWHWSBBKJW-YEKVWAHSSA-N |
| XLogP | 4.75 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|