C18H22F3NO4 — CID 155475666
3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 155475666) has the molecular formula C18H22F3NO4 and a molecular weight of 373.37 g/mol. Its IUPAC name is 3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 155475666 |
| Molecular Formula | C18H22F3NO4 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)NCCCOC(=O)/C=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H22F3NO4/c1-17(2,3)26-16(24)22-11-4-12-25-15(23)10-7-13-5-8-14(9-6-13)18(19,20)21/h5-10H,4,11-12H2,1-3H3,(H,22,24)/b10-7+ |
| InChIKey | ZWNXWKVYNBISIW-JXMROGBWSA-N |
| XLogP | 4.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|