C20H23F3N2O4 — CID 91992024
tert-butyl N-[2-[[2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methoxy]ethyl]carbamate (PubChem CID 91992024) has the molecular formula C20H23F3N2O4 and a molecular weight of 412.41 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 91992024 |
| Molecular Formula | C20H23F3N2O4 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | tert-butyl N-[2-[[2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCc1coc(/C=C/c2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C20H23F3N2O4/c1-19(2,3)29-18(26)24-10-11-27-12-16-13-28-17(25-16)9-6-14-4-7-15(8-5-14)20(21,22)23/h4-9,13H,10-12H2,1-3H3,(H,24,26)/b9-6+ |
| InChIKey | GSRQEKRLHOLMPX-RMKNXTFCSA-N |
| XLogP | 4.91 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|