C28H34N2O4 — CID 148558055
tert-butyl N-[4-[4-[[2-[(E)-2-(4-methylphenyl)ethenyl]-1,3-oxazol-4-yl]methoxy]phenyl]butyl]carbamate (PubChem CID 148558055) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[[2-[(E)-2-(4-methylphenyl)ethenyl]-1,3-oxazol-4-yl]methoxy]phenyl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[[2-[(E)-2-(4-methylphenyl)ethenyl]-1,3-oxazol-4-yl]methoxy]phenyl]butyl]carbamate |
|---|---|
| PubChem CID | 148558055 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | tert-butyl N-[4-[4-[[2-[(E)-2-(4-methylphenyl)ethenyl]-1,3-oxazol-4-yl]methoxy]phenyl]butyl]carbamate |
| SMILES | Cc1ccc(/C=C/c2nc(COc3ccc(CCCCNC(=O)OC(C)(C)C)cc3)co2)cc1 |
| InChI | InChI=1S/C28H34N2O4/c1-21-8-10-23(11-9-21)14-17-26-30-24(20-33-26)19-32-25-15-12-22(13-16-25)7-5-6-18-29-27(31)34-28(2,3)4/h8-17,20H,5-7,18-19H2,1-4H3,(H,29,31)/b17-14+ |
| InChIKey | MULLTOWPZVHYIL-SAPNQHFASA-N |
| XLogP | 6.58 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|