C31H34N4O6 — CID 163692748
diethyl 1-[4-[4-[[2-[(E)-2-(4-methylphenyl)ethenyl]-1,3-oxazol-4-yl]methoxy]phenyl]butyl]triazole-4,5-dicarboxylate (PubChem CID 163692748) has the molecular formula C31H34N4O6 and a molecular weight of 558.64 g/mol. Its IUPAC name is diethyl 1-[4-[4-[[2-[(E)-2-(4-methylphenyl)ethenyl]-1,3-oxazol-4-yl]methoxy]phenyl]butyl]triazole-4,5-dicarboxylate.
| Compound Name | diethyl 1-[4-[4-[[2-[(E)-2-(4-methylphenyl)ethenyl]-1,3-oxazol-4-yl]methoxy]phenyl]butyl]triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 163692748 |
| Molecular Formula | C31H34N4O6 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | diethyl 1-[4-[4-[[2-[(E)-2-(4-methylphenyl)ethenyl]-1,3-oxazol-4-yl]methoxy]phenyl]butyl]triazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1nnn(CCCCc2ccc(OCc3coc(/C=C/c4ccc(C)cc4)n3)cc2)c1C(=O)OCC |
| InChI | InChI=1S/C31H34N4O6/c1-4-38-30(36)28-29(31(37)39-5-2)35(34-33-28)19-7-6-8-23-13-16-26(17-14-23)40-20-25-21-41-27(32-25)18-15-24-11-9-22(3)10-12-24/h9-18,21H,4-8,19-20H2,1-3H3/b18-15+ |
| InChIKey | JUIWSXVRFOOGIL-OBGWFSINSA-N |
| XLogP | 5.70 |
| TPSA | 118.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|