C26H25F3N4O3 — CID 11670521
4-[[4-[4-(1-methyltriazol-4-yl)butyl]phenoxy]methyl]-2-[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]-1,3-oxazole (PubChem CID 11670521) has the molecular formula C26H25F3N4O3 and a molecular weight of 498.51 g/mol. Its IUPAC name is 4-[[4-[4-(1-methyltriazol-4-yl)butyl]phenoxy]methyl]-2-[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]-1,3-oxazole.
| Compound Name | 4-[[4-[4-(1-methyltriazol-4-yl)butyl]phenoxy]methyl]-2-[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 11670521 |
| Molecular Formula | C26H25F3N4O3 |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 4-[[4-[4-(1-methyltriazol-4-yl)butyl]phenoxy]methyl]-2-[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]-1,3-oxazole |
| SMILES | Cn1cc(CCCCc2ccc(OCc3coc(/C=C/c4ccc(OC(F)(F)F)cc4)n3)cc2)nn1 |
| InChI | InChI=1S/C26H25F3N4O3/c1-33-16-21(31-32-33)5-3-2-4-19-6-11-23(12-7-19)34-17-22-18-35-25(30-22)15-10-20-8-13-24(14-9-20)36-26(27,28)29/h6-16,18H,2-5,17H2,1H3/b15-10+ |
| InChIKey | DJQWUBIOWNFQSO-XNTDXEJSSA-N |
| XLogP | 6.02 |
| TPSA | 75.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|