C25H25F3N4O7S — CID 11215375
methanesulfonic acid;4-[[4-[2-(triazol-1-yl)ethoxymethyl]phenoxy]methyl]-2-[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]-1,3-oxazole (PubChem CID 11215375) has the molecular formula C25H25F3N4O7S and a molecular weight of 582.56 g/mol. Its IUPAC name is methanesulfonic acid;4-[[4-[2-(triazol-1-yl)ethoxymethyl]phenoxy]methyl]-2-[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]-1,3-oxazole.
| Compound Name | methanesulfonic acid;4-[[4-[2-(triazol-1-yl)ethoxymethyl]phenoxy]methyl]-2-[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 11215375 |
| Molecular Formula | C25H25F3N4O7S |
| Molecular Weight | 582.56 g/mol |
| Exact Mass | 582.14 |
| IUPAC Name | methanesulfonic acid;4-[[4-[2-(triazol-1-yl)ethoxymethyl]phenoxy]methyl]-2-[(E)-2-[4-(trifluoromethoxy)phenyl]ethenyl]-1,3-oxazole |
| SMILES | CS(=O)(=O)O.FC(F)(F)Oc1ccc(/C=C/c2nc(COc3ccc(COCCn4ccnn4)cc3)co2)cc1 |
| InChI | InChI=1S/C24H21F3N4O4.CH4O3S/c25-24(26,27)35-22-8-1-18(2-9-22)5-10-23-29-20(17-34-23)16-33-21-6-3-19(4-7-21)15-32-14-13-31-12-11-28-30-31;1-5(2,3)4/h1-12,17H,13-16H2;1H3,(H,2,3,4)/b10-5+; |
| InChIKey | XIDMYBIZUKTUHB-OAZHBLANSA-N |
| XLogP | 4.63 |
| TPSA | 138.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|