C25H26F3N3O2 — CID 142263941
(Z)-6-[4-[[2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methoxy]phenyl]hex-1-ene-1,2-diamine (PubChem CID 142263941) has the molecular formula C25H26F3N3O2 and a molecular weight of 457.50 g/mol. Its IUPAC name is (Z)-6-[4-[[2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methoxy]phenyl]hex-1-ene-1,2-diamine.
| Compound Name | (Z)-6-[4-[[2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methoxy]phenyl]hex-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 142263941 |
| Molecular Formula | C25H26F3N3O2 |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | (Z)-6-[4-[[2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methoxy]phenyl]hex-1-ene-1,2-diamine |
| SMILES | N/C=C(\N)CCCCc1ccc(OCc2coc(/C=C/c3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C25H26F3N3O2/c26-25(27,28)20-10-5-19(6-11-20)9-14-24-31-22(17-33-24)16-32-23-12-7-18(8-13-23)3-1-2-4-21(30)15-29/h5-15,17H,1-4,16,29-30H2/b14-9+,21-15- |
| InChIKey | LFGAUXYFSRNYCO-DKDWZUBTSA-N |
| XLogP | 5.91 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|