C27H24F3N3O2 — CID 139970300
4-[2-[4-(3-pyrimidin-5-ylpropoxy)phenyl]ethyl]-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazole (PubChem CID 139970300) has the molecular formula C27H24F3N3O2 and a molecular weight of 479.50 g/mol. Its IUPAC name is 4-[2-[4-(3-pyrimidin-5-ylpropoxy)phenyl]ethyl]-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazole.
| Compound Name | 4-[2-[4-(3-pyrimidin-5-ylpropoxy)phenyl]ethyl]-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 139970300 |
| Molecular Formula | C27H24F3N3O2 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 4-[2-[4-(3-pyrimidin-5-ylpropoxy)phenyl]ethyl]-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazole |
| SMILES | FC(F)(F)c1ccc(/C=C/c2nc(CCc3ccc(OCCCc4cncnc4)cc3)co2)cc1 |
| InChI | InChI=1S/C27H24F3N3O2/c28-27(29,30)23-9-3-20(4-10-23)8-14-26-33-24(18-35-26)11-5-21-6-12-25(13-7-21)34-15-1-2-22-16-31-19-32-17-22/h3-4,6-10,12-14,16-19H,1-2,5,11,15H2/b14-8+ |
| InChIKey | TUBJWQUVTFLABT-RIYZIHGNSA-N |
| XLogP | 6.45 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|