C27H24F3N3O3 — CID 139970211
1-[3-[4-[2-[2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]ethyl]phenoxy]propyl]imidazole-2-carbaldehyde (PubChem CID 139970211) has the molecular formula C27H24F3N3O3 and a molecular weight of 495.50 g/mol. Its IUPAC name is 1-[3-[4-[2-[2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]ethyl]phenoxy]propyl]imidazole-2-carbaldehyde.
| Compound Name | 1-[3-[4-[2-[2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]ethyl]phenoxy]propyl]imidazole-2-carbaldehyde |
|---|---|
| PubChem CID | 139970211 |
| Molecular Formula | C27H24F3N3O3 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 1-[3-[4-[2-[2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]ethyl]phenoxy]propyl]imidazole-2-carbaldehyde |
| SMILES | O=Cc1nccn1CCCOc1ccc(CCc2coc(/C=C/c3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C27H24F3N3O3/c28-27(29,30)22-8-2-20(3-9-22)7-13-26-32-23(19-36-26)10-4-21-5-11-24(12-6-21)35-17-1-15-33-16-14-31-25(33)18-34/h2-3,5-9,11-14,16,18-19H,1,4,10,15,17H2/b13-7+ |
| InChIKey | SQCOULSBCNOTFZ-NTUHNPAUSA-N |
| XLogP | 6.13 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|