C28H25F3N2O2 — CID 139970287
4-[[4-(4-pyridin-2-ylbutyl)phenoxy]methyl]-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazole (PubChem CID 139970287) has the molecular formula C28H25F3N2O2 and a molecular weight of 478.51 g/mol. Its IUPAC name is 4-[[4-(4-pyridin-2-ylbutyl)phenoxy]methyl]-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazole.
| Compound Name | 4-[[4-(4-pyridin-2-ylbutyl)phenoxy]methyl]-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 139970287 |
| Molecular Formula | C28H25F3N2O2 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 4-[[4-(4-pyridin-2-ylbutyl)phenoxy]methyl]-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazole |
| SMILES | FC(F)(F)c1ccc(/C=C/c2nc(COc3ccc(CCCCc4ccccn4)cc3)co2)cc1 |
| InChI | InChI=1S/C28H25F3N2O2/c29-28(30,31)23-13-8-22(9-14-23)12-17-27-33-25(20-35-27)19-34-26-15-10-21(11-16-26)5-1-2-6-24-7-3-4-18-32-24/h3-4,7-18,20H,1-2,5-6,19H2/b17-12+ |
| InChIKey | AJVPPVCXPUIDGX-SFQUDFHCSA-N |
| XLogP | 7.40 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|