C25H22ClF3N4O3 — CID 173172773
CID 173172773 (PubChem CID 173172773) has the molecular formula C25H22ClF3N4O3 and a molecular weight of 518.92 g/mol.
| Compound Name | CID 173172773 |
|---|---|
| PubChem CID | 173172773 |
| Molecular Formula | C25H22ClF3N4O3 |
| Molecular Weight | 518.92 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | — |
| SMILES | FC(F)(F)Oc1ccc(C=Cc2nc(COc3ccc(CCCCN4C=[C+]N=N4)cc3)co2)cc1.[Cl-] |
| InChI | InChI=1S/C25H22F3N4O3.ClH/c26-25(27,28)35-23-11-6-20(7-12-23)8-13-24-30-21(18-34-24)17-33-22-9-4-19(5-10-22)3-1-2-15-32-16-14-29-31-32;/h4-13,16,18H,1-3,15,17H2;1H/q+1;/p-1 |
| InChIKey | AHSSUMOQJDTESW-UHFFFAOYSA-M |
| XLogP | 3.61 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.92 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|