C20H17F4NO3 — CID 6218455
[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 6218455) has the molecular formula C20H17F4NO3 and a molecular weight of 395.35 g/mol. Its IUPAC name is [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 6218455 |
| Molecular Formula | C20H17F4NO3 |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(C(F)(F)F)cc1)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H17F4NO3/c21-17-8-3-15(4-9-17)11-12-25-18(26)13-28-19(27)10-5-14-1-6-16(7-2-14)20(22,23)24/h1-10H,11-13H2,(H,25,26)/b10-5+ |
| InChIKey | UFLSQEDVBOAZHT-BJMVGYQFSA-N |
| XLogP | 3.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|