C20H19F3N2O5S — CID 29155171
[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 29155171) has the molecular formula C20H19F3N2O5S and a molecular weight of 456.44 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 29155171 |
| Molecular Formula | C20H19F3N2O5S |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)COC(=O)/C=C/c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H19F3N2O5S/c21-20(22,23)16-3-1-2-15(12-16)6-9-19(27)30-13-18(26)25-11-10-14-4-7-17(8-5-14)31(24,28)29/h1-9,12H,10-11,13H2,(H,25,26)(H2,24,28,29)/b9-6+ |
| InChIKey | BETRTIZKBXKZPK-RMKNXTFCSA-N |
| XLogP | 2.27 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|