C19H19FN2O5S — CID 7767128
[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 7767128) has the molecular formula C19H19FN2O5S and a molecular weight of 406.44 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7767128 |
| Molecular Formula | C19H19FN2O5S |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)COC(=O)/C=C/c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H19FN2O5S/c20-16-6-1-14(2-7-16)5-10-19(24)27-13-18(23)22-12-11-15-3-8-17(9-4-15)28(21,25)26/h1-10H,11-13H2,(H,22,23)(H2,21,25,26)/b10-5+ |
| InChIKey | ZAPPAQRYFAWZGF-BJMVGYQFSA-N |
| XLogP | 1.39 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|