C19H18Cl2N2O5S — CID 42967486
[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 42967486) has the molecular formula C19H18Cl2N2O5S and a molecular weight of 457.34 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 42967486 |
| Molecular Formula | C19H18Cl2N2O5S |
| Molecular Weight | 457.34 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)COC(=O)/C=C/c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H18Cl2N2O5S/c20-16-7-3-14(11-17(16)21)4-8-19(25)28-12-18(24)23-10-9-13-1-5-15(6-2-13)29(22,26)27/h1-8,11H,9-10,12H2,(H,23,24)(H2,22,26,27)/b8-4+ |
| InChIKey | UXIVSPAMMGNEAA-XBXARRHUSA-N |
| XLogP | 2.56 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|