C16H22BrN3O3 — CID 108909019
tert-butyl N-[2-[[(E)-2-(4-bromophenyl)ethenyl]carbamoylamino]ethyl]carbamate (PubChem CID 108909019) has the molecular formula C16H22BrN3O3 and a molecular weight of 384.27 g/mol. Its IUPAC name is tert-butyl N-[2-[[(E)-2-(4-bromophenyl)ethenyl]carbamoylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(E)-2-(4-bromophenyl)ethenyl]carbamoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 108909019 |
| Molecular Formula | C16H22BrN3O3 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | tert-butyl N-[2-[[(E)-2-(4-bromophenyl)ethenyl]carbamoylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)N/C=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H22BrN3O3/c1-16(2,3)23-15(22)20-11-10-19-14(21)18-9-8-12-4-6-13(17)7-5-12/h4-9H,10-11H2,1-3H3,(H,20,22)(H2,18,19,21)/b9-8+ |
| InChIKey | AUXVDVAVVILDNR-CMDGGOBGSA-N |
| XLogP | 3.24 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|