C14H16N2O4 — CID 51521239
methyl N-[(Z)-2-[4-[(Z)-2-(methoxycarbonylamino)ethenyl]phenyl]ethenyl]carbamate (PubChem CID 51521239) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is methyl N-[(Z)-2-[4-[(Z)-2-(methoxycarbonylamino)ethenyl]phenyl]ethenyl]carbamate.
| Compound Name | methyl N-[(Z)-2-[4-[(Z)-2-(methoxycarbonylamino)ethenyl]phenyl]ethenyl]carbamate |
|---|---|
| PubChem CID | 51521239 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | methyl N-[(Z)-2-[4-[(Z)-2-(methoxycarbonylamino)ethenyl]phenyl]ethenyl]carbamate |
| SMILES | COC(=O)N/C=C\c1ccc(/C=C\NC(=O)OC)cc1 |
| InChI | InChI=1S/C14H16N2O4/c1-19-13(17)15-9-7-11-3-5-12(6-4-11)8-10-16-14(18)20-2/h3-10H,1-2H3,(H,15,17)(H,16,18)/b9-7-,10-8- |
| InChIKey | FZULAHKVJDOLJE-XOHWUJONSA-N |
| XLogP | 2.34 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |