C10H11NO3 — CID 21422485
methyl N-[(E)-2-(4-hydroxyphenyl)ethenyl]carbamate (PubChem CID 21422485) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is methyl N-[(E)-2-(4-hydroxyphenyl)ethenyl]carbamate.
| Compound Name | methyl N-[(E)-2-(4-hydroxyphenyl)ethenyl]carbamate |
|---|---|
| PubChem CID | 21422485 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | methyl N-[(E)-2-(4-hydroxyphenyl)ethenyl]carbamate |
| SMILES | COC(=O)N/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C10H11NO3/c1-14-10(13)11-7-6-8-2-4-9(12)5-3-8/h2-7,12H,1H3,(H,11,13)/b7-6+ |
| InChIKey | OOVYDYPWXWZNEQ-VOTSOKGWSA-N |
| XLogP | 1.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |