C18H17NO5 — CID 46232536
(Z)-3-(3,4-dihydroxyphenyl)-N-[(E)-2-(4-hydroxyphenyl)ethenyl]-2-methoxyprop-2-enamide (PubChem CID 46232536) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is (Z)-3-(3,4-dihydroxyphenyl)-N-[(E)-2-(4-hydroxyphenyl)ethenyl]-2-methoxyprop-2-enamide.
| Compound Name | (Z)-3-(3,4-dihydroxyphenyl)-N-[(E)-2-(4-hydroxyphenyl)ethenyl]-2-methoxyprop-2-enamide |
|---|---|
| PubChem CID | 46232536 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | (Z)-3-(3,4-dihydroxyphenyl)-N-[(E)-2-(4-hydroxyphenyl)ethenyl]-2-methoxyprop-2-enamide |
| SMILES | CO/C(=C\c1ccc(O)c(O)c1)C(=O)N/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C18H17NO5/c1-24-17(11-13-4-7-15(21)16(22)10-13)18(23)19-9-8-12-2-5-14(20)6-3-12/h2-11,20-22H,1H3,(H,19,23)/b9-8+,17-11- |
| InChIKey | CYLIDDWGNZLNAO-JMAVEDQASA-N |
| XLogP | 2.58 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|