C18H19NO5 — CID 46232496
(Z)-N-[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-3-(4-hydroxyphenyl)-2-methoxyprop-2-enamide (PubChem CID 46232496) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is (Z)-N-[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-3-(4-hydroxyphenyl)-2-methoxyprop-2-enamide.
| Compound Name | (Z)-N-[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-3-(4-hydroxyphenyl)-2-methoxyprop-2-enamide |
|---|---|
| PubChem CID | 46232496 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | (Z)-N-[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-3-(4-hydroxyphenyl)-2-methoxyprop-2-enamide |
| SMILES | CO/C(=C\c1ccc(O)cc1)C(=O)NCC(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H19NO5/c1-24-17(10-12-2-6-14(20)7-3-12)18(23)19-11-16(22)13-4-8-15(21)9-5-13/h2-10,16,20-22H,11H2,1H3,(H,19,23)/b17-10- |
| InChIKey | DEIGDDBJHQFPRY-YVLHZVERSA-N |
| XLogP | 1.93 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|