C16H25NO4 — CID 173177567
N,N-diethylethanamine;(Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoic acid (PubChem CID 173177567) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is N,N-diethylethanamine;(Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoic acid.
| Compound Name | N,N-diethylethanamine;(Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 173177567 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | N,N-diethylethanamine;(Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoic acid |
| SMILES | CCN(CC)CC.CO/C(=C\c1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C10H10O4.C6H15N/c1-14-9(10(12)13)6-7-2-4-8(11)5-3-7;1-4-7(5-2)6-3/h2-6,11H,1H3,(H,12,13);4-6H2,1-3H3/b9-6-; |
| InChIKey | OHUCAGJLFYSGKB-BORNJIKYSA-N |
| XLogP | 2.81 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|