About ethanamine;(Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoic acid
ethanamine;(Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoic acid (PubChem CID 173177600) has the molecular formula C12H17NO4
and a molecular weight of 239.27 g/mol. Its IUPAC name is ethanamine;(Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoic acid.
Molecular Properties
| Compound Name | ethanamine;(Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoic acid |
| PubChem CID | 173177600 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | ethanamine;(Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoic acid |
| SMILES | CCN.CO/C(=C\c1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C10H10O4.C2H7N/c1-14-9(10(12)13)6-7-2-4-8(11)5-3-7;1-2-3/h2-6,11H,1H3,(H,12,13);2-3H2,1H3/b9-6-; |
| InChIKey | ZTHDKGIHVSEASJ-BORNJIKYSA-N |
| XLogP | 1.43 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethanamine;(Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;(Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoic acid?
The IUPAC name of ethanamine;(Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoic acid (CID 173177600) is ethanamine;(Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoic acid.
What is the SMILES notation for ethanamine;(Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoic acid?
The canonical SMILES for ethanamine;(Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoic acid is CCN.CO/C(=C\c1ccc(O)cc1)C(=O)O.
What is the InChIKey of ethanamine;(Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoic acid?
The InChIKey is ZTHDKGIHVSEASJ-BORNJIKYSA-N. The full InChI is InChI=1S/C10H10O4.C2H7N/c1-14-9(10(12)13)6-7-2-4-8(11)5-3-7;1-2-3/h2-6,11H,1H3,(H,12,13);2-3H2,1H3/b9-6-;.
What are the key properties of ethanamine;(Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoic acid?
ethanamine;(Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoic acid has a molecular weight of 239.27 g/mol, XLogP of 1.43, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;(Z)-3-(4-hydroxyphenyl)-2-methoxyprop-2-enoic acid is sourced from PubChem (CID 173177600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).