C21H23NO7 — CID 90287762
[4-[(E)-3-[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]-3-oxoprop-1-enyl]-2,6-dimethoxyphenyl] acetate (PubChem CID 90287762) has the molecular formula C21H23NO7 and a molecular weight of 401.42 g/mol. Its IUPAC name is [4-[(E)-3-[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]-3-oxoprop-1-enyl]-2,6-dimethoxyphenyl] acetate.
| Compound Name | [4-[(E)-3-[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]-3-oxoprop-1-enyl]-2,6-dimethoxyphenyl] acetate |
|---|---|
| PubChem CID | 90287762 |
| Molecular Formula | C21H23NO7 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | [4-[(E)-3-[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]-3-oxoprop-1-enyl]-2,6-dimethoxyphenyl] acetate |
| SMILES | COc1cc(/C=C/C(=O)NCC(O)c2ccc(O)cc2)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C21H23NO7/c1-13(23)29-21-18(27-2)10-14(11-19(21)28-3)4-9-20(26)22-12-17(25)15-5-7-16(24)8-6-15/h4-11,17,24-25H,12H2,1-3H3,(H,22,26)/b9-4+ |
| InChIKey | CRUWCZZBRVDRDG-RUDMXATFSA-N |
| XLogP | 2.20 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|