C19H21NO4 — CID 11267400
(E)-N-[(2S)-2-hydroxy-2-(4-methoxyphenyl)ethyl]-3-(3-methoxyphenyl)prop-2-enamide (PubChem CID 11267400) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is (E)-N-[(2S)-2-hydroxy-2-(4-methoxyphenyl)ethyl]-3-(3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(2S)-2-hydroxy-2-(4-methoxyphenyl)ethyl]-3-(3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 11267400 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (E)-N-[(2S)-2-hydroxy-2-(4-methoxyphenyl)ethyl]-3-(3-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc([C@H](O)CNC(=O)/C=C/c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C19H21NO4/c1-23-16-9-7-15(8-10-16)18(21)13-20-19(22)11-6-14-4-3-5-17(12-14)24-2/h3-12,18,21H,13H2,1-2H3,(H,20,22)/b11-6+/t18-/m1/s1 |
| InChIKey | KGPMFFWJOFQSEL-PMQIGOLDSA-N |
| XLogP | 2.57 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|