C15H13F2NO3 — CID 6733826
2,6-difluoro-N-[2-hydroxy-2-(4-hydroxyphenyl)ethyl]benzamide (PubChem CID 6733826) has the molecular formula C15H13F2NO3 and a molecular weight of 293.27 g/mol. Its IUPAC name is 2,6-difluoro-N-[2-hydroxy-2-(4-hydroxyphenyl)ethyl]benzamide.
| Compound Name | 2,6-difluoro-N-[2-hydroxy-2-(4-hydroxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 6733826 |
| Molecular Formula | C15H13F2NO3 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2,6-difluoro-N-[2-hydroxy-2-(4-hydroxyphenyl)ethyl]benzamide |
| SMILES | O=C(NCC(O)c1ccc(O)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C15H13F2NO3/c16-11-2-1-3-12(17)14(11)15(21)18-8-13(20)9-4-6-10(19)7-5-9/h1-7,13,19-20H,8H2,(H,18,21) |
| InChIKey | BJYQYHYTNUZCRI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |