C15H12Cl2FNO2 — CID 167783306
4-chloro-N-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide (PubChem CID 167783306) has the molecular formula C15H12Cl2FNO2 and a molecular weight of 328.17 g/mol. Its IUPAC name is 4-chloro-N-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide.
| Compound Name | 4-chloro-N-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 167783306 |
| Molecular Formula | C15H12Cl2FNO2 |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 4-chloro-N-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide |
| SMILES | O=C(NCC(O)c1ccc(Cl)cc1)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C15H12Cl2FNO2/c16-10-3-1-9(2-4-10)14(20)8-19-15(21)12-6-5-11(17)7-13(12)18/h1-7,14,20H,8H2,(H,19,21) |
| InChIKey | WMADTATZOCMOGD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |