C16H14Cl2FNO2 — CID 110910978
2-(2,5-dichlorophenyl)-N-[2-(4-fluorophenyl)-2-hydroxyethyl]acetamide (PubChem CID 110910978) has the molecular formula C16H14Cl2FNO2 and a molecular weight of 342.20 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-N-[2-(4-fluorophenyl)-2-hydroxyethyl]acetamide.
| Compound Name | 2-(2,5-dichlorophenyl)-N-[2-(4-fluorophenyl)-2-hydroxyethyl]acetamide |
|---|---|
| PubChem CID | 110910978 |
| Molecular Formula | C16H14Cl2FNO2 |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-N-[2-(4-fluorophenyl)-2-hydroxyethyl]acetamide |
| SMILES | O=C(Cc1cc(Cl)ccc1Cl)NCC(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H14Cl2FNO2/c17-12-3-6-14(18)11(7-12)8-16(22)20-9-15(21)10-1-4-13(19)5-2-10/h1-7,15,21H,8-9H2,(H,20,22) |
| InChIKey | YQKQTZKJHBTKPE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |