C18H16ClFN2O2 — CID 110931259
N-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-(6-fluoro-1H-indol-3-yl)acetamide (PubChem CID 110931259) has the molecular formula C18H16ClFN2O2 and a molecular weight of 346.79 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-(6-fluoro-1H-indol-3-yl)acetamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-(6-fluoro-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 110931259 |
| Molecular Formula | C18H16ClFN2O2 |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-(6-fluoro-1H-indol-3-yl)acetamide |
| SMILES | O=C(Cc1c[nH]c2cc(F)ccc12)NCC(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClFN2O2/c19-13-3-1-11(2-4-13)17(23)10-22-18(24)7-12-9-21-16-8-14(20)5-6-15(12)16/h1-6,8-9,17,21,23H,7,10H2,(H,22,24) |
| InChIKey | CJAZEQSLIYGUAQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |