C18H17FN2O — CID 113209373
2-(6-fluoro-1H-indol-3-yl)-N-(1-phenylethyl)acetamide (PubChem CID 113209373) has the molecular formula C18H17FN2O and a molecular weight of 296.35 g/mol. Its IUPAC name is 2-(6-fluoro-1H-indol-3-yl)-N-(1-phenylethyl)acetamide.
| Compound Name | 2-(6-fluoro-1H-indol-3-yl)-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 113209373 |
| Molecular Formula | C18H17FN2O |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-(6-fluoro-1H-indol-3-yl)-N-(1-phenylethyl)acetamide |
| SMILES | CC(NC(=O)Cc1c[nH]c2cc(F)ccc12)c1ccccc1 |
| InChI | InChI=1S/C18H17FN2O/c1-12(13-5-3-2-4-6-13)21-18(22)9-14-11-20-17-10-15(19)7-8-16(14)17/h2-8,10-12,20H,9H2,1H3,(H,21,22) |
| InChIKey | RZDZTOIAKYJADV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |