C22H20N2O — CID 40810685
2-(1H-indol-3-yl)-N-[(1S)-1-naphthalen-2-ylethyl]acetamide (PubChem CID 40810685) has the molecular formula C22H20N2O and a molecular weight of 328.42 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-[(1S)-1-naphthalen-2-ylethyl]acetamide.
| Compound Name | 2-(1H-indol-3-yl)-N-[(1S)-1-naphthalen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 40810685 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-[(1S)-1-naphthalen-2-ylethyl]acetamide |
| SMILES | C[C@H](NC(=O)Cc1c[nH]c2ccccc12)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H20N2O/c1-15(17-11-10-16-6-2-3-7-18(16)12-17)24-22(25)13-19-14-23-21-9-5-4-8-20(19)21/h2-12,14-15,23H,13H2,1H3,(H,24,25)/t15-/m0/s1 |
| InChIKey | FRSOXGNHNDLXOI-HNNXBMFYSA-N |
| XLogP | 4.74 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |