C18H19N3O3S — CID 78813976
2-(1H-indol-3-yl)-N-[1-(3-sulfamoylphenyl)ethyl]acetamide (PubChem CID 78813976) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-[1-(3-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-(1H-indol-3-yl)-N-[1-(3-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 78813976 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-[1-(3-sulfamoylphenyl)ethyl]acetamide |
| SMILES | CC(NC(=O)Cc1c[nH]c2ccccc12)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C18H19N3O3S/c1-12(13-5-4-6-15(9-13)25(19,23)24)21-18(22)10-14-11-20-17-8-3-2-7-16(14)17/h2-9,11-12,20H,10H2,1H3,(H,21,22)(H2,19,23,24) |
| InChIKey | YAWCYTQCMFMGKU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |