C14H15N2O4- — CID 7678364
(2S,3S)-3-hydroxy-2-[[2-(1H-indol-3-yl)acetyl]amino]butanoate (PubChem CID 7678364) has the molecular formula C14H15N2O4- and a molecular weight of 275.28 g/mol. Its IUPAC name is (2S,3S)-3-hydroxy-2-[[2-(1H-indol-3-yl)acetyl]amino]butanoate.
| Compound Name | (2S,3S)-3-hydroxy-2-[[2-(1H-indol-3-yl)acetyl]amino]butanoate |
|---|---|
| PubChem CID | 7678364 |
| Molecular Formula | C14H15N2O4- |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | (2S,3S)-3-hydroxy-2-[[2-(1H-indol-3-yl)acetyl]amino]butanoate |
| SMILES | C[C@H](O)[C@H](NC(=O)Cc1c[nH]c2ccccc12)C(=O)[O-] |
| InChI | InChI=1S/C14H16N2O4/c1-8(17)13(14(19)20)16-12(18)6-9-7-15-11-5-3-2-4-10(9)11/h2-5,7-8,13,15,17H,6H2,1H3,(H,16,18)(H,19,20)/p-1/t8-,13-/m0/s1 |
| InChIKey | BCHACWAJZOMXHR-SDBXPKJASA-M |
| XLogP | -0.67 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |