C16H20N2O2S2 — CID 147372892
S-sulfanyl (2S,3S)-2-[[2-(1H-indol-3-yl)acetyl]amino]-3-methylpentanethioate (PubChem CID 147372892) has the molecular formula C16H20N2O2S2 and a molecular weight of 336.48 g/mol. Its IUPAC name is S-sulfanyl (2S,3S)-2-[[2-(1H-indol-3-yl)acetyl]amino]-3-methylpentanethioate.
| Compound Name | S-sulfanyl (2S,3S)-2-[[2-(1H-indol-3-yl)acetyl]amino]-3-methylpentanethioate |
|---|---|
| PubChem CID | 147372892 |
| Molecular Formula | C16H20N2O2S2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | S-sulfanyl (2S,3S)-2-[[2-(1H-indol-3-yl)acetyl]amino]-3-methylpentanethioate |
| SMILES | CC[C@H](C)[C@H](NC(=O)Cc1c[nH]c2ccccc12)C(=O)SS |
| InChI | InChI=1S/C16H20N2O2S2/c1-3-10(2)15(16(20)22-21)18-14(19)8-11-9-17-13-7-5-4-6-12(11)13/h4-7,9-10,15,17,21H,3,8H2,1-2H3,(H,18,19)/t10-,15-/m0/s1 |
| InChIKey | DJLJFMIFULROFR-BONVTDFDSA-N |
| XLogP | 3.35 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|