C27H35N3O4 — CID 91142794
(2S)-N-[1-(2,3-dihydroxyphenyl)pentan-3-yl]-2-[[2-(1H-indol-3-yl)acetyl]amino]-3-methylpentanamide (PubChem CID 91142794) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is (2S)-N-[1-(2,3-dihydroxyphenyl)pentan-3-yl]-2-[[2-(1H-indol-3-yl)acetyl]amino]-3-methylpentanamide.
| Compound Name | (2S)-N-[1-(2,3-dihydroxyphenyl)pentan-3-yl]-2-[[2-(1H-indol-3-yl)acetyl]amino]-3-methylpentanamide |
|---|---|
| PubChem CID | 91142794 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | (2S)-N-[1-(2,3-dihydroxyphenyl)pentan-3-yl]-2-[[2-(1H-indol-3-yl)acetyl]amino]-3-methylpentanamide |
| SMILES | CCC(CCc1cccc(O)c1O)NC(=O)[C@@H](NC(=O)Cc1c[nH]c2ccccc12)C(C)CC |
| InChI | InChI=1S/C27H35N3O4/c1-4-17(3)25(30-24(32)15-19-16-28-22-11-7-6-10-21(19)22)27(34)29-20(5-2)14-13-18-9-8-12-23(31)26(18)33/h6-12,16-17,20,25,28,31,33H,4-5,13-15H2,1-3H3,(H,29,34)(H,30,32)/t17?,20?,25-/m0/s1 |
| InChIKey | LJDSLIUQSCQJAH-ZPZJFZDTSA-N |
| XLogP | 4.18 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|