C24H33N3O4 — CID 57160966
(2S)-N-[1-(2,3-dihydroxyphenyl)pentan-3-yl]-3-methyl-2-[(2-pyridin-3-ylacetyl)amino]pentanamide (PubChem CID 57160966) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is (2S)-N-[1-(2,3-dihydroxyphenyl)pentan-3-yl]-3-methyl-2-[(2-pyridin-3-ylacetyl)amino]pentanamide.
| Compound Name | (2S)-N-[1-(2,3-dihydroxyphenyl)pentan-3-yl]-3-methyl-2-[(2-pyridin-3-ylacetyl)amino]pentanamide |
|---|---|
| PubChem CID | 57160966 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | (2S)-N-[1-(2,3-dihydroxyphenyl)pentan-3-yl]-3-methyl-2-[(2-pyridin-3-ylacetyl)amino]pentanamide |
| SMILES | CCC(CCc1cccc(O)c1O)NC(=O)[C@@H](NC(=O)Cc1cccnc1)C(C)CC |
| InChI | InChI=1S/C24H33N3O4/c1-4-16(3)22(27-21(29)14-17-8-7-13-25-15-17)24(31)26-19(5-2)12-11-18-9-6-10-20(28)23(18)30/h6-10,13,15-16,19,22,28,30H,4-5,11-12,14H2,1-3H3,(H,26,31)(H,27,29)/t16?,19?,22-/m0/s1 |
| InChIKey | OJYUNPBFNFURRV-NZBFNNPHSA-N |
| XLogP | 3.09 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|