C23H35N4O6P — CID 58841921
2-aminoethyl 2-[[(2S,3S)-2-[[2-(1H-indol-3-yl)acetyl]amino]-3-methylpentanoyl]amino]ethyl prop-2-enyl phosphate (PubChem CID 58841921) has the molecular formula C23H35N4O6P and a molecular weight of 494.53 g/mol. Its IUPAC name is 2-aminoethyl 2-[[(2S,3S)-2-[[2-(1H-indol-3-yl)acetyl]amino]-3-methylpentanoyl]amino]ethyl prop-2-enyl phosphate.
| Compound Name | 2-aminoethyl 2-[[(2S,3S)-2-[[2-(1H-indol-3-yl)acetyl]amino]-3-methylpentanoyl]amino]ethyl prop-2-enyl phosphate |
|---|---|
| PubChem CID | 58841921 |
| Molecular Formula | C23H35N4O6P |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 2-aminoethyl 2-[[(2S,3S)-2-[[2-(1H-indol-3-yl)acetyl]amino]-3-methylpentanoyl]amino]ethyl prop-2-enyl phosphate |
| SMILES | C=CCOP(=O)(OCCN)OCCNC(=O)[C@@H](NC(=O)Cc1c[nH]c2ccccc12)[C@@H](C)CC |
| InChI | InChI=1S/C23H35N4O6P/c1-4-12-31-34(30,32-13-10-24)33-14-11-25-23(29)22(17(3)5-2)27-21(28)15-18-16-26-20-9-7-6-8-19(18)20/h4,6-9,16-17,22,26H,1,5,10-15,24H2,2-3H3,(H,25,29)(H,27,28)/t17-,22-,34?/m0/s1 |
| InChIKey | GZODVKJFNYROMV-HDACSCITSA-N |
| XLogP | 2.66 |
| TPSA | 144.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|