C19H25ClN2O2 — CID 58842077
2-(5-chloro-1H-indol-3-yl)-N-[(4S,5S)-2,5-dimethyl-3-oxoheptan-4-yl]acetamide (PubChem CID 58842077) has the molecular formula C19H25ClN2O2 and a molecular weight of 348.87 g/mol. Its IUPAC name is 2-(5-chloro-1H-indol-3-yl)-N-[(4S,5S)-2,5-dimethyl-3-oxoheptan-4-yl]acetamide.
| Compound Name | 2-(5-chloro-1H-indol-3-yl)-N-[(4S,5S)-2,5-dimethyl-3-oxoheptan-4-yl]acetamide |
|---|---|
| PubChem CID | 58842077 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2-(5-chloro-1H-indol-3-yl)-N-[(4S,5S)-2,5-dimethyl-3-oxoheptan-4-yl]acetamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)Cc1c[nH]c2ccc(Cl)cc12)C(=O)C(C)C |
| InChI | InChI=1S/C19H25ClN2O2/c1-5-12(4)18(19(24)11(2)3)22-17(23)8-13-10-21-16-7-6-14(20)9-15(13)16/h6-7,9-12,18,21H,5,8H2,1-4H3,(H,22,23)/t12-,18-/m0/s1 |
| InChIKey | YUDQASHLCOFIIE-SGTLLEGYSA-N |
| XLogP | 4.12 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |