C11H11ClN2O2 — CID 110611810
2-(5-chloro-1H-indol-3-yl)-N-methoxyacetamide (PubChem CID 110611810) has the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. Its IUPAC name is 2-(5-chloro-1H-indol-3-yl)-N-methoxyacetamide.
| Compound Name | 2-(5-chloro-1H-indol-3-yl)-N-methoxyacetamide |
|---|---|
| PubChem CID | 110611810 |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 2-(5-chloro-1H-indol-3-yl)-N-methoxyacetamide |
| SMILES | CONC(=O)Cc1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C11H11ClN2O2/c1-16-14-11(15)4-7-6-13-10-3-2-8(12)5-9(7)10/h2-3,5-6,13H,4H2,1H3,(H,14,15) |
| InChIKey | RMSNYIXUIVBQKZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|