C19H17ClN2O3 — CID 110428322
ethyl 2-[[2-(5-chloro-1H-indol-3-yl)acetyl]amino]benzoate (PubChem CID 110428322) has the molecular formula C19H17ClN2O3 and a molecular weight of 356.81 g/mol. Its IUPAC name is ethyl 2-[[2-(5-chloro-1H-indol-3-yl)acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-(5-chloro-1H-indol-3-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 110428322 |
| Molecular Formula | C19H17ClN2O3 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | ethyl 2-[[2-(5-chloro-1H-indol-3-yl)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)Cc1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H17ClN2O3/c1-2-25-19(24)14-5-3-4-6-17(14)22-18(23)9-12-11-21-16-8-7-13(20)10-15(12)16/h3-8,10-11,21H,2,9H2,1H3,(H,22,23) |
| InChIKey | GPYXSQQDFCFUAA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |