C19H15ClN2O4 — CID 113208895
ethyl 2-[[2-(6-chloro-1H-indol-3-yl)-2-oxoacetyl]amino]benzoate (PubChem CID 113208895) has the molecular formula C19H15ClN2O4 and a molecular weight of 370.79 g/mol. Its IUPAC name is ethyl 2-[[2-(6-chloro-1H-indol-3-yl)-2-oxoacetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-(6-chloro-1H-indol-3-yl)-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 113208895 |
| Molecular Formula | C19H15ClN2O4 |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | ethyl 2-[[2-(6-chloro-1H-indol-3-yl)-2-oxoacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)C(=O)c1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C19H15ClN2O4/c1-2-26-19(25)13-5-3-4-6-15(13)22-18(24)17(23)14-10-21-16-9-11(20)7-8-12(14)16/h3-10,21H,2H2,1H3,(H,22,24) |
| InChIKey | ULQOGJYHRLOVMR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|