C18H15ClN2O2 — CID 113208820
2-(6-chloro-1H-indol-3-yl)-N-(2,5-dimethylphenyl)-2-oxoacetamide (PubChem CID 113208820) has the molecular formula C18H15ClN2O2 and a molecular weight of 326.78 g/mol. Its IUPAC name is 2-(6-chloro-1H-indol-3-yl)-N-(2,5-dimethylphenyl)-2-oxoacetamide.
| Compound Name | 2-(6-chloro-1H-indol-3-yl)-N-(2,5-dimethylphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 113208820 |
| Molecular Formula | C18H15ClN2O2 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-(6-chloro-1H-indol-3-yl)-N-(2,5-dimethylphenyl)-2-oxoacetamide |
| SMILES | Cc1ccc(C)c(NC(=O)C(=O)c2c[nH]c3cc(Cl)ccc23)c1 |
| InChI | InChI=1S/C18H15ClN2O2/c1-10-3-4-11(2)15(7-10)21-18(23)17(22)14-9-20-16-8-12(19)5-6-13(14)16/h3-9,20H,1-2H3,(H,21,23) |
| InChIKey | FVBXBRYDWWEGHR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|