C14H17ClN2O2 — CID 71299888
tert-butyl N-[(5-chloro-1H-indol-3-yl)methyl]carbamate (PubChem CID 71299888) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. Its IUPAC name is tert-butyl N-[(5-chloro-1H-indol-3-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(5-chloro-1H-indol-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 71299888 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | tert-butyl N-[(5-chloro-1H-indol-3-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C14H17ClN2O2/c1-14(2,3)19-13(18)17-8-9-7-16-12-5-4-10(15)6-11(9)12/h4-7,16H,8H2,1-3H3,(H,17,18) |
| InChIKey | DBPLAYJMAOZAHW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |