C17H23ClN2O2 — CID 113084309
tert-butyl N-[2-(5-chloro-1H-indol-3-yl)-2-methylpropyl]carbamate (PubChem CID 113084309) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is tert-butyl N-[2-(5-chloro-1H-indol-3-yl)-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[2-(5-chloro-1H-indol-3-yl)-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 113084309 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | tert-butyl N-[2-(5-chloro-1H-indol-3-yl)-2-methylpropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(C)(C)c1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C17H23ClN2O2/c1-16(2,3)22-15(21)20-10-17(4,5)13-9-19-14-7-6-11(18)8-12(13)14/h6-9,19H,10H2,1-5H3,(H,20,21) |
| InChIKey | MGPXGKRQXDWKFK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |