C18H19ClN2OS — CID 113084290
N-[2-(5-chloro-1H-indol-3-yl)-2-methylpropyl]-2-thiophen-2-ylacetamide (PubChem CID 113084290) has the molecular formula C18H19ClN2OS and a molecular weight of 346.88 g/mol. Its IUPAC name is N-[2-(5-chloro-1H-indol-3-yl)-2-methylpropyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[2-(5-chloro-1H-indol-3-yl)-2-methylpropyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 113084290 |
| Molecular Formula | C18H19ClN2OS |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-[2-(5-chloro-1H-indol-3-yl)-2-methylpropyl]-2-thiophen-2-ylacetamide |
| SMILES | CC(C)(CNC(=O)Cc1cccs1)c1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C18H19ClN2OS/c1-18(2,11-21-17(22)9-13-4-3-7-23-13)15-10-20-16-6-5-12(19)8-14(15)16/h3-8,10,20H,9,11H2,1-2H3,(H,21,22) |
| InChIKey | FHOHMKMFIBZZCV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |