C9H8F3NO2 — CID 104917965
N-(2,2-difluoroethyl)-2-fluoro-6-hydroxybenzamide (PubChem CID 104917965) has the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2-fluoro-6-hydroxybenzamide.
| Compound Name | N-(2,2-difluoroethyl)-2-fluoro-6-hydroxybenzamide |
|---|---|
| PubChem CID | 104917965 |
| Molecular Formula | C9H8F3NO2 |
| Molecular Weight | 219.16 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | N-(2,2-difluoroethyl)-2-fluoro-6-hydroxybenzamide |
| SMILES | O=C(NCC(F)F)c1c(O)cccc1F |
| InChI | InChI=1S/C9H8F3NO2/c10-5-2-1-3-6(14)8(5)9(15)13-4-7(11)12/h1-3,7,14H,4H2,(H,13,15) |
| InChIKey | HIKKPQAPIPMVNU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.16 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |